Glyceric acid
![]() | |
Names | |
---|---|
IUPAC name
2,3-Dihydroxypropanoic acid | |
Other names
Glycerate | |
Identifiers | |
473-81-4 ![]() | |
ChemSpider | 732 ![]() |
Jmol 3D model | Interactive image |
PubChem | 752 |
| |
| |
Properties | |
C3H6O4 | |
Molar mass | 106.08 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). | |
![]() ![]() ![]() | |
Infobox references | |
Glyceric acid is a natural three-carbon sugar acid. Salts and esters of glyceric acid are known as glycerates.
glycerol after reacting with gym-an oxygen giving reagent (such as KMnO4+H2SO4) produced glyceric acid.
KMnO4+3H2SO4=K2SO4+3H20+5[O] CH2OH-CHOH-CH2OH+[O]=CH2OH-CHOH-COOH+H2O
Biochemistry
Several phosphate derivatives of glyceric acid, including 2-phosphoglyceric acid, 3-phosphoglyceric acid, 2,3-bisphosphoglyceric acid, and 1,3-bisphosphoglyceric acid, are important biochemical intermediates in Glycolysis.
3-phospho-Glyceric acid is an important molecule for the biosynthesis of a certain amino acid, Serine (Ser,S) which can therefore be used for the synthesis of Cysteine (Cys,C) and Glycine (Gly,G)
References
- ↑ Merck Index, 11th Edition, 4378.
2. J.Berg,J.L.Tymoczko,L.Stryer. Biochemistry,7th edition.