4-Chlorophenoxyacetic acid

4-Chlorophenoxyacetic acid

Names
IUPAC name 2-(4-Chlorophenoxy)acetic acid
Other names Parachlorophenoxyacetate; 4-Chlorophenoxyacetate; pCPA
Identifiers
CAS Number	122-88-3
ChEBI	CHEBI:1808
ChEMBL	ChEMBL178018
ChemSpider	24438
Jmol 3D model	Interactive image
KEGG	C07088
PubChem	26229
InChI InChI=1S/C8H7ClO3/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2,(H,10,11) Key: SODPIMGUZLOIPE-UHFFFAOYSA-N InChI=1/C8H7ClO3/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2,(H,10,11) Key: SODPIMGUZLOIPE-UHFFFAOYAE
SMILES Clc1ccc(OCC(=O)O)cc1
Properties
Chemical formula	C8H7ClO3
Molar mass	186.59 g·mol^−1
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
verify (what is  ?)
Infobox references

4-Chlorophenoxyacetic acid or parachlorophenoxyacetate (pCPA) is a synthetic pesticide similar to chemicals in a group of plant hormones called auxins.^[1]

Precursor Applications

1. Esterized with dimethylethanolamine (DMAE) it forms centrophenoxine.
2. Via its acid chloride, pCPA reacts with 2-aminoethyldiethylamine to form the amide drug Clofexamide.
3. In the case of Clofibrate, the methylene hydrogens are replaced by methyl groups, and the acid is an ethyl ester.
4. The acyl chloride of pCPA is used to make famotine, an antiviral.
5. Iproclozide is based on the structure of iproniazid.

References

1. 4-CPA Data Sheet, alanwood.net

External links

• Reregistration Eligibility Decision (RED): 4-Chlorophenoxy-acetic Acid (4-CPA), United States Environmental Protection Agency