Hypholomine B

Hypholomine B

Names
IUPAC name 2-(3,4-Dihydroxyphenyl)-6-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-3-(4-hydroxy-6-oxopyran-2-yl)-2,3-dihydrofuro[3,2-c]pyran-4-one
Identifiers
ChEMBL	ChEMBL1682260
Jmol interactive 3D	Image
PubChem	54737531
InChI InChI=1S/C26H18O10/c27-14-9-20(35-22(32)10-14)23-24-21(36-25(23)13-3-6-17(29)19(31)8-13)11-15(34-26(24)33)4-1-12-2-5-16(28)18(30)7-12/h1-11,23,25,27-31H/b4-1+ Key: CGMQDMKDINCGOB-DAFODLJHSA-N
SMILES C1=CC(=C(C=C1/C=C/C2=CC3=C(C(C(O3)C4=CC(=C(C=C4)O)O)C5=CC(=CC(=O)O5)O)C(=O)O2)O)O
Properties
Chemical formula	C26H18O10
Molar mass	490.42 g·mol^−1
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references

Hypholomine B is a neuraminidase inhibitor isolated from the fungus Phellinus linteus.^[1]

References

1. Yeom, JH; Lee, IK; Ki, DW; Lee, MS; Seok, SJ; Yun, BS (2012). "Neuraminidase Inhibitors from the Culture Broth of Phellinus linteus". Mycobiology 40 (2): 142–4. doi:10.5941/MYCO.2012.40.2.142. PMC 3408306. PMID 22870059.