Roseophilin

Roseophilin

Names
IUPAC name 15-[5-(3-Chloro-1H-pyrrol-2-yl)-3-methoxy-furan-2-yl]-13-isopropyl-2-aza-tricyclo[10.2.1.13,14]hexadeca-1(15),2-triene
Identifiers
CAS Number	142386-38-7
ChEMBL	ChEMBL1945189
ChemSpider	4578301
Jmol interactive 3D	Image
PubChem	5467324
InChI InChI=1S/C27H33ClN2O2/c1-16(2)23-18-11-9-7-5-4-6-8-10-17-14-19(23)25(30-17)24(18)27-22(31-3)15-21(32-27)26-20(28)12-13-29-26/h12-16,18,23,30H,4-11H2,1-3H3/b26-21-,27-24- Key: XEQIXGXEBJYNMG-OLPWBVPVSA-N InChI=1/C27H33ClN2O2/c1-16(2)23-18-11-9-7-5-4-6-8-10-17-14-19(23)25(30-17)24(18)27-22(31-3)15-21(32-27)26-20(28)12-13-29-26/h12-16,18,23,30H,4-11H2,1-3H3/b26-21-,27-24- Key: XEQIXGXEBJYNMG-OLPWBVPVBQ
SMILES Cl\C\5=C\C=N/C/5=C4\O/C(=C2\c1nc3cc1C(C(C)C)C2CCCCCCCC3)/C(/OC)=C4
Properties
Chemical formula	C27H33ClN2O2
Molar mass	453.02 g/mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
verify (what is  ?)
Infobox references

Roseophilin is an antibiotic isolated from Streptomyces griscovirides shown to have antitumor activity.^[1] The chemical structure can be considered in terms of two components, a macrotricyclic segment and a heterocyclic side-chain. Several laboratory syntheses of roseophilin (e.g., those of Trost, Furstner, Salamone) are based upon the Paal-Knorr synthesis, and two others are based on the Nazarov cyclization reaction (those of Tius, Frontier).

References

1. Furstner, A. (2003). Angew. Chem. Int. Ed. 42 (3582-3603). Missing or empty |title= (help)