m-Coumaric acid
m-Coumaric acid
 |
| Names |
| IUPAC name
3-(3-hydroxyphenyl)propanoic acid |
| Other names
meta-coumaric acid 3-hydroxycinnamic acid |
| Identifiers |
| |
621-54-5 |
| ChEBI |
CHEBI:CHEBI:32357 |
| ChemSpider |
553147 |
| EC Number |
209-615-0 |
| Jmol interactive 3D |
Image |
| KEGG |
C12621 |
| PubChem |
637541 |
InChI=1S/C9H8O3/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-6,10H,(H,11,12)/b5-4+ Key: KKSDGJDHHZEWEP-SNAWJCMRSA-N InChI=1/C9H8O3/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-6,10H,(H,11,12)/b5-4+ Key: KKSDGJDHHZEWEP-SNAWJCMRBO
|
C1=CC(=CC(=C1)O)/C=C/C(=O)O
|
| Properties |
| |
C9H8O3 |
| Molar mass |
164.16 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
| Infobox references |
|
|
m-Coumaric acid is a hydroxycinnamic acid, an organic compound that is a hydroxy derivative of cinnamic acid. There are three isomers of coumaric acids - o-coumaric acid, m-coumaric acid, and p-coumaric acid- that differ by the position of the hydroxy substitution of the phenyl group.
m-Coumaric acid can be found in vinegar.
External links
References
|
|---|
| | Aglycones | Precursor | |
|---|
| Monohydroxycinnamic acids (Coumaric acids) | |
|---|
| | |
|---|
| Trihydroxycinnamic acids | |
|---|
| O-methylated forms | |
|---|
| others | |
|---|
|
|---|
| | Esters | glycoside-likes | Esters of caffeic acid with cyclitols | esters of quinic acid |
- Chlorogenic acid (3-caffeoylquinic acid)
- Cryptochlorogenic acid (4-O-caffeoylquinic acid)
- Neochlorogenic acid (5-O-Caffeoylquinic acid)
- Cynarine (1,5-dicaffeoylquinic acid)
- 3,4-dicaffeoylquinic acid
- 3,5-dicaffeoylquinic acid
|
|---|
| esters of shikimic acid | |
|---|
|
|---|
| Glycosides | |
|---|
|
|---|
| Tartaric acid esters | |
|---|
| Other esters with caffeic acid | |
|---|
| Caffeoyl phenylethanoid glycoside (CPG) |
- Echinacoside
- Calceolarioside A, B, C and F
- Chiritoside A, B and C
- Cistanoside A, B, C, D, E, F, G an H
- Conandroside
- Myconoside
- Pauoifloside
- Plantainoside A
- Plantamajoside
- Tubuloside B
- Verbascoside (Isoverbascoside, 2'-Acetylverbascoside)
|
|---|
|
|---|
| | Oligomeric forms | Dimers |
- Diferulic acids (DiFA) : 5,5'-Diferulic acid, 8-O-4'-Diferulic acid, 8,5'-Diferulic acid, 8,5'-DiFA (DC), 8,5'-DiFA (BF), 8,8'-Diferulic acid
|
|---|
| Trimers | |
|---|
| Tetramers | |
|---|
|
|---|
| Conjugates with coenzyme A (CoA) | |
|---|
|