p-Coumaric acid glucoside
      
p-Coumaric acid glucoside
 
|  | 
| Names | 
| IUPAC name (E)-3-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoic acid | 
| Other names p-Coumaric acid 4-O-glucoside | 
| Identifiers | 
|  | 14364-05-7 | 
| ChemSpider | 8016010 | 
| Jmol interactive 3D | Image | 
| PubChem | 9840292 | 
| 
InChI=1S/C15H18O8/c16-7-10-12(19)13(20)14(21)15(23-10)22-9-4-1-8(2-5-9)3-6-11(17)18/h1-6,10,12-16,19-21H,7H2,(H,17,18)/b6-3+/t10-,12-,13+,14-,15-/m1/s1 Key: LJFYQZQUAULRDF-FDGSXQGBSA-NInChI=1/C15H18O8/c16-7-10-12(19)13(20)14(21)15(23-10)22-9-4-1-8(2-5-9)3-6-11(17)18/h1-6,10,12-16,19-21H,7H2,(H,17,18)/b6-3+/t10-,12-,13+,14-,15-/m1/s1 Key: LJFYQZQUAULRDF-FDGSXQGBBA
 | 
| 
C1=CC(=CC=C1/C=C/C(=O)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O
 | 
| Properties | 
|  | C15H18O8 | 
| Molar mass | 326.29 g/mol | 
| Except where otherwise noted, data are given for materials in their standard state  (at 25 °C [77 °F], 100 kPa). | 
|
| Infobox references | 
|  |  | 
p-Coumaric acid glucoside is a hydroxycinnamic acid, an organic compound found in commercial breads containing flaxseed.[1]
 References 
- ↑  Phenolic glucosides in bread containing flaxseed. C. Strandås, A. Kamal-Eldin, R. Andersson and P. Åman, Food Chemistry, Volume 110, Issue 4, 15 October 2008, Pages 997–999, doi:10.1016/j.foodchem.2008.02.088
 External links 
| |  | 
|---|
 |  |  | Aglycones | | Precursor |  | 
|---|
 |  |  | Monohydroxycinnamic acids(Coumaric acids)
 |  | 
|---|
 |  |  |  |  | 
|---|
 |  |  | Trihydroxycinnamic acids |  | 
|---|
 |  |  | O-methylated forms |  | 
|---|
 |  |  | others |  | 
|---|
 | 
|---|
 |  |  | Esters | | glycoside-likes | | Esters ofcaffeic acid
 with cyclitols
 | | esters ofquinic acid
 | 
 Chlorogenic acid (3-caffeoylquinic acid) Cryptochlorogenic acid (4-O-caffeoylquinic acid) Neochlorogenic acid (5-O-Caffeoylquinic acid) Cynarine (1,5-dicaffeoylquinic acid) 3,4-dicaffeoylquinic acid 3,5-dicaffeoylquinic acid
 | 
|---|
 |  |  | esters ofshikimic acid
 |  | 
|---|
 | 
|---|
 |  |  | Glycosides |  | 
|---|
 | 
|---|
 |  |  | Tartaric acid esters |  | 
|---|
 |  |  | Other esterswith caffeic acid
 |  | 
|---|
 |  |  | Caffeoyl phenylethanoidglycoside (CPG)
 | 
 Echinacoside  Calceolarioside A, B, C and F Chiritoside A, B and C  Cistanoside A, B, C, D, E, F, G an H Conandroside  Myconoside  Pauoifloside  Plantainoside A  Plantamajoside  Tubuloside B  Verbascoside (Isoverbascoside, 2'-Acetylverbascoside)
 | 
|---|
 | 
|---|
 |  |  | Oligomeric forms | | Dimers | 
 Diferulic acids (DiFA) : 5,5'-Diferulic acid, 8-O-4'-Diferulic acid, 8,5'-Diferulic acid,  8,5'-DiFA (DC), 8,5'-DiFA (BF), 8,8'-Diferulic acid
 | 
|---|
 |  |  | Trimers |  | 
|---|
 |  |  | Tetramers |  | 
|---|
 | 
|---|
 |  |  | Conjugates with coenzyme A (CoA)
 |  | 
|---|
 |