Scillavone B
Scillavone B
 |
| Identifiers |
| |
1105671-01-9 |
| ChemSpider |
32077067 |
| Jmol interactive 3D |
Image |
InChI=1S/C18H18O7/c1-23-14-7-13-15(17(22)18(14)24-2)16(21)10(8-25-13)5-9-3-4-11(19)12(20)6-9/h3-4,6-7,10,19-20,22H,5,8H2,1-2H3/t10-/m0/s1 Key: IWDPSYVRXCJSRF-JTQLQIEISA-N
|
COc1cc2c(c(c1OC)O)C(=O)[C@H](CO2)Cc3ccc(c(c3)O)O
|
| Properties |
| |
C18H18O7 |
| Molar mass |
346.33 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
|
| Infobox references |
|
|
Scillavone B is a homoisoflavone that can be isolated from the bulbs of Scilla scilloides[1] (Barnardia japonica).
References
- ↑ A new homostilbene and two new homoisoflavones from the bulbs of Scilla scilloides. Nishida Y, Eto M, Miyashita H, Ikeda T, Yamaguchi K, Yoshimitsu H, Nohara T and Ono M, Chem Pharm Bull (Tokyo)., July 2008, volume56, issue 7, pages 1022-1025, PubMed
External links
|
|---|
| | Homoisoflavonoids |
- Portulacanones A, B, C and D
|
|---|
| | 3,4-Dihydroxyhomoisoflavans | |
|---|
| | Homoisoflavones |
- Autumnalin and 3,9-dihydro-autumnalin
- Punctatin and 4′-o-Methyl-punctatin
- scillavones A and B
|
|---|
| | Homoisoflavanones |
- Eucomin
- Eucomol
- Sappanone A
- Scillascillin
- 3-(4'-Methoxybenzyl)-7,8-methylenedioxy-chroman-4-one
- 5,7-Dihydroxy-3-(3-hydroxy-4-methoxybenzyl)-chroman-4-one
C-Methylated homoisoflavanones |
- 3-(4'-methoxy-benzyl)-5,7-dihydroxy-6-methyl-8-methoxy-chroman-4-one
- 3-(4'-methoxy-benzyl)-5,7-dihydroxy-6,8-dimethyl-chroman-4-one
- 3-(4'-hydroxy-benzyl)-5,7-dihydroxy-6,8-dimethyl-chroman-4-one
- 3-(4'-hydroxy-benzyl)-5,7-dihydroxy-6-methyl-8-methoxy-chroman-4-one
- 3-(4'-hydroxy-benzyl)-5,7-dihydroxy-6-methyl-chroman-4-one
|
|---|
| Homoisoflavanone glycosides |
- (-)-7-O-methyleucomol 5-O-beta-D-glucopyranoside
- (-)-7-O-methyleucomol 5-O-beta-rutinoside
- (-)-7-O-methyleucomol 5-O-beta-neohesperidoside
|
|---|
|
|---|
|