Vat Blue 36
Vat Blue 36
 |
| Names |
| IUPAC name
5-Chloro-2-(5,7-dichloro-3-oxo-1-benzothiophen-2(3H)-ylidene)-7-methoxy-4-methyl-1,2-dihydro-3H-indol-3-one |
| Identifiers |
| |
6424-69-7 |
| ChemSpider |
23351917 |
| Jmol interactive 3D |
Image |
| PubChem |
53439004 |
InChI=1S/C18H10Cl3NO3S/c1-6-9(20)5-11(25-2)13-12(6)16(24)14(22-13)18-15(23)8-3-7(19)4-10(21)17(8)26-18/h3-5,22H,1-2H3 Key: CFDCBVJUEASQPX-UHFFFAOYSA-N InChI=1/C18H10Cl3NO3S/c1-6-9(20)5-11(25-2)13-12(6)16(24)14(22-13)18-15(23)8-3-7(19)4-10(21)17(8)26-18/h3-5,22H,1-2H3 Key: CFDCBVJUEASQPX-UHFFFAOYAI
|
Cc1c(cc(c2c1C(=O)C(=C3C(=O)c4cc(cc(c4S3)Cl)Cl)N2)OC)Cl
|
| Properties |
| |
C18H10Cl3NO3S |
| Molar mass |
426.69 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
| Infobox references |
|
|
Vat Blue 36 is a vat dye that is chemically related to indigo. it is produced by condensation of 4-methyl-5-chloro-7-methoxy-3-indolinone and 5,7–dichloro-3-(2H)-thianaphthenone. [1]
References
|
|---|
| | Techniques | | |
|---|
| | Types of dyes | |
|---|
| | Traditional textile dyes | |
|---|
| | History | |
|---|
| | Craft dyes | |
|---|
| | Reference | |
|---|
|