Vat Yellow 1
Vat Yellow 1
 |
| Names |
| Other names
FLAVANTHRONE, Pigment Yellow 24, Flavanthrene, Indofast Yellow, Sandothrene NGN, benz[5,6]acridino[2,1,9,8-klmna]benz[h]acridine-8,16-dione |
| Identifiers |
| |
57-88-5 |
| ChEMBL |
ChEMBL137369 |
| ChemSpider |
61374 |
| Jmol interactive 3D |
Image |
| PubChem |
68059 |
InChI=1S/C28H12N2O2/c31-27-15-7-3-1-5-13(15)25-21-17(27)9-12-20-23(21)24-19(29-25)11-10-18-22(24)26(30-20)14-6-2-4-8-16(14)28(18)32/h1-12H Key: KJPJZBYFYBYKPK-UHFFFAOYSA-N
|
C1=CC=C2C(=C1)C3=NC4=C5C6=C(C=C4)C(=O)C7=CC=CC=C7C6=NC8=C5C3=C(C2=O)C=C8
|
| Properties |
| |
C28H12O2N2 |
| Molar mass |
408.40708 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
| Infobox references |
|
|
Vat Yellow 1 is sort of vat dye. Molecular structure of Vat Yellow 1 is anthraquinone.[1]
References
|
|---|
| | Techniques | | |
|---|
| | Types of dyes | |
|---|
| | Traditional textile dyes | |
|---|
| | History | |
|---|
| | Craft dyes | |
|---|
| | Reference | |
|---|
|