Dactylifric acid
Dactylifric acid
 |
Names |
IUPAC name
5-{[(2Z)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-3,4-dihydroxycyclohex-1-ene-1-carboxylic acid |
Other names
3-O-Caffeoylshikimic acid |
Identifiers |
|
6082-44-6 |
ChemSpider |
29420736 |
Jmol interactive 3D |
Image |
InChI=1S/C16H16O8/c17-10-3-1-8(5-11(10)18)2-4-14(20)24-13-7-9(16(22)23)6-12(19)15(13)21/h1-5,7,12-13,15,17-19,21H,6H2,(H,22,23)/b4-2+/t12-,13-,15-/m1/s1 Key: MRDAXWGGWWDUKL-GDDAOPKQSA-N InChI=1/C16H16O8/c17-10-3-1-8(5-11(10)18)2-4-14(20)24-13-7-9(16(22)23)6-12(19)15(13)21/h1-5,7,12-13,15,17-19,21H,6H2,(H,22,23)/b4-2+/t12-,13-,15-/m1/s1 Key: MRDAXWGGWWDUKL-GDDAOPKQBO
|
C1[C@H]([C@H]([C@@H](C=C1C(=O)O)OC(=O)/C=C/C2=CC(=C(C=C2)O)O)O)O
|
Properties |
|
C16H16O8 |
Molar mass |
336.29 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Infobox references |
|
|
Dactylifric acid is a caffeic acid glycoside (3-O-caffeoylshikimic acid). It and its isomers are enzymic browning substrates found in dates (Phoenix dactylifera fruits).[1]
References
- ↑ Maier, VP; Metzler, DM; Huber, AF (1964). "3-O-Caffeoylshikimic acid (dactylifric acid) and its isomers, a new class of enzymic browning substrates". Biochemical and Biophysical Research Communications 14: 124–8. doi:10.1016/0006-291x(64)90241-4. PMID 5836492.
External links
|
---|
| Aglycones | Precursor | |
---|
| Monohydroxycinnamic acids (Coumaric acids) | |
---|
| | |
---|
| Trihydroxycinnamic acids | |
---|
| O-methylated forms | |
---|
| others | |
---|
|
---|
| Esters | glycoside-likes | Esters of caffeic acid with cyclitols | esters of quinic acid |
- Chlorogenic acid (3-caffeoylquinic acid)
- Cryptochlorogenic acid (4-O-caffeoylquinic acid)
- Neochlorogenic acid (5-O-Caffeoylquinic acid)
- Cynarine (1,5-dicaffeoylquinic acid)
- 3,4-dicaffeoylquinic acid
- 3,5-dicaffeoylquinic acid
|
---|
| esters of shikimic acid | |
---|
|
---|
| Glycosides | |
---|
|
---|
| Tartaric acid esters | |
---|
| Other esters with caffeic acid | |
---|
| Caffeoyl phenylethanoid glycoside (CPG) |
- Echinacoside
- Calceolarioside A, B, C and F
- Chiritoside A, B and C
- Cistanoside A, B, C, D, E, F, G an H
- Conandroside
- Myconoside
- Pauoifloside
- Plantainoside A
- Plantamajoside
- Tubuloside B
- Verbascoside (Isoverbascoside, 2'-Acetylverbascoside)
|
---|
|
---|
| Oligomeric forms | Dimers |
- Diferulic acids (DiFA) : 5,5'-Diferulic acid, 8-O-4'-Diferulic acid, 8,5'-Diferulic acid, 8,5'-DiFA (DC), 8,5'-DiFA (BF), 8,8'-Diferulic acid
|
---|
| Trimers | |
---|
| Tetramers | |
---|
|
---|
| Conjugates with coenzyme A (CoA) | |
---|
|