Decarboxylated 8,5'-diferulic acid
      
Decarboxylated 8,5'-diferulic acid
 
 .png)  | 
| Names | 
|  Other names
 8,5'-DiFA (DC) 8,5'-diFA (decarboxylated form)  | 
| Identifiers | 
|  ChemSpider | 
 8512879 | 
|  Jmol interactive 3D | 
 Image | 
|  PubChem | 
 10337420 | 
 
InChI=1S/C19H18O6/c1-24-16-10-12(4-7-15(16)20)3-6-14-9-13(5-8-18(21)22)11-17(25-2)19(14)23/h3-11,20,23H,1-2H3,(H,21,22)/b6-3+,8-5+ Key: SLIMCXCSQXYCGL-JENUQAQBSA-N InChI=1/C19H18O6/c1-24-16-10-12(4-7-15(16)20)3-6-14-9-13(5-8-18(21)22)11-17(25-2)19(14)23/h3-11,20,23H,1-2H3,(H,21,22)/b6-3+,8-5+ Key: SLIMCXCSQXYCGL-JENUQAQBBX  
  | 
 
Oc2c(OC)cc(\C=C\C(O)=O)cc2\C=C\c(cc1OC)ccc1O  
  | 
| Properties | 
|   | 
 C19H18O6 | 
|  Molar mass | 
 342.35 g·mol−1   | 
 Except where otherwise noted, data are given for materials in their  standard state (at 25  °C [77  °F], 100  kPa).  | 
|  Infobox references | 
 | 
 | 
Decarboxylated 8,5'-diferulic acid is a molecule included in the group but is not a true diferulic acid. It is found in maize bran.[1]
 See also 
 References 
- ↑  Bunzel, M; Funk, C; Steinhart, H (2004). "Semipreparative isolation of dehydrodiferulic and dehydrotriferulic acids as standard substances from maize bran". Journal of separation science 27 (13): 1080–6. doi:10.1002/jssc.200301703. PMID 15495409. 
 
 
 | 
|---|
  |  | Aglycones | Precursor  |  | 
|---|
  |  Monohydroxycinnamic acids (Coumaric acids)  |  | 
|---|
  |   |  | 
|---|
  |  Trihydroxycinnamic acids  |  | 
|---|
  |  O-methylated forms  |  | 
|---|
  |  others  |  | 
|---|
 
  | 
|---|
  |  | Esters | glycoside-likes  | Esters of caffeic acid with cyclitols  | esters of quinic acid  | 
-  Chlorogenic acid (3-caffeoylquinic acid)
 
-  Cryptochlorogenic acid (4-O-caffeoylquinic acid)
 
-  Neochlorogenic acid (5-O-Caffeoylquinic acid)
 
-  Cynarine (1,5-dicaffeoylquinic acid)
 
-  3,4-dicaffeoylquinic acid
 
-  3,5-dicaffeoylquinic acid
  
  | 
|---|
  |  esters of shikimic acid  |  | 
|---|
 
  | 
|---|
  |  Glycosides  |  | 
|---|
 
  | 
|---|
  |  Tartaric acid esters  |  | 
|---|
  |  Other esters with caffeic acid  |  | 
|---|
  |  Caffeoyl phenylethanoid  glycoside (CPG)  | 
-  Echinacoside 
 
-  Calceolarioside A, B, C and F
 
-  Chiritoside A, B and C 
 
-  Cistanoside A, B, C, D, E, F, G an H
 
-  Conandroside 
 
-  Myconoside 
 
-  Pauoifloside 
 
-  Plantainoside A 
 
-  Plantamajoside 
 
-  Tubuloside B 
 
-  Verbascoside (Isoverbascoside, 2'-Acetylverbascoside)
  
  | 
|---|
 
  | 
|---|
  |  | Oligomeric forms | Dimers  | 
-  Diferulic acids (DiFA) : 5,5'-Diferulic acid, 8-O-4'-Diferulic acid, 8,5'-Diferulic acid,  8,5'-DiFA (DC), 8,5'-DiFA (BF), 8,8'-Diferulic acid
  
  | 
|---|
  |  Trimers  |  | 
|---|
  |  Tetramers  |  | 
|---|
 
  | 
|---|
  |  Conjugates with coenzyme A (CoA) |  | 
|---|
 
  |