(1,2,5,6-Tetrahydropyridin-4-yl)methylphosphinic acid
(1,2,5,6-Tetrahydropyridin-4-yl)methylphosphinic acid
|
Names |
IUPAC name
Methyl(1,2,3,6-tetrahydropyridin-4-yl)phosphinic acid |
Other names
TPMPA |
Identifiers |
|
182485-36-5 N |
ChEMBL |
ChEMBL397209 Y |
ChemSpider |
5319 Y |
|
4328 |
Jmol interactive 3D |
Image Image |
PubChem |
5521 |
InChI=1S/C6H12NO2P/c1-10(8,9)6-2-4-7-5-3-6/h2,7H,3-5H2,1H3,(H,8,9) YKey: MFUKVPOVVKKLRQ-UHFFFAOYSA-N YInChI=1/C6H12NO2P/c1-10(8,9)6-2-4-7-5-3-6/h2,7H,3-5H2,1H3,(H,8,9) Key: MFUKVPOVVKKLRQ-UHFFFAOYAY
|
CP(=O)(C1=CCNCC1)O O=P([O-])(/C1=C/C[NH2+]CC1)C
|
Properties |
|
C6H12NO2P |
Molar mass |
161.14 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
N verify (what is YN ?) |
Infobox references |
|
|
(1,2,5,6-Tetrahydropyridin-4-yl)methylphosphinic acid (TPMPA) is a GABA antagonist selective for the GABAA-ρ (previously known as GABAC) subtype.[1]
References
- ↑ Li, Shifeng; Zhang, Yunbin; Liu, Haixiong; Yan, Yuanchang; Li, Yiping (2008). "Identification and expression of GABACreceptor in rat testis and spermatozoa". Acta Biochimica et Biophysica Sinica 40 (8): 761–7. doi:10.1111/j.1745-7270.2008.00453.x. PMID 18685793.
|
---|
| Receptor (ligands) | | Agonists | |
---|
| PAMs |
- (abridged; see here for a full list): α-EMTBL
- Alcohols (e.g., ethanol)
- Avermectins (e.g., ivermectin)
- Barbiturates (e.g., phenobarbital)
- Benzodiazepines (e.g., diazepam)
- Bromide compounds (e.g., potassium bromide)
- Carbamates (e.g., meprobamate)
- Carbamazepine
- Chloralose
- Chlormezanone
- Clomethiazole
- Dihydroergolines (e.g., ergoloid (dihydroergotoxine))
- Etazepine
- Etifoxine
- Fenamates (e.g., mefenamic acid)
- Flavonoids (e.g., apigenin, hispidulin)
- Fluoxetine
- Flupirtine
- Imidazoles (e.g., etomidate)
- Kava constituents (e.g., kavain)
- Lanthanum
- Loreclezole
- Monastrol
- Neuroactive steroids (e.g., allopregnanolone, cholesterol)
- Niacin
- Nicotinamide (niacinamide)
- Nonbenzodiazepines (e.g., β-carbolines (e.g., abecarnil), cyclopyrrolones (e.g., zopiclone), imidazopyridines (e.g., zolpidem), pyrazolopyrimidines (e.g., zaleplon))
- Norfluoxetine
- Petrichloral
- Phenols (e.g., propofol)
- Phenytoin
- Piperidinediones (e.g., glutethimide)
- Propanidid
- Pyrazolopyridines (e.g., etazolate)
- Quinazolinones (e.g., methaqualone)
- Retigabine (ezogabine)
- ROD-188
- Skullcap constituents (e.g., baicalin)
- Stiripentol
- Sulfonylalkanes (e.g., sulfonmethane (sulfonal))
- Topiramate
- Valerian constituents (e.g., valerenic acid)
- Volatiles/gases (e.g., chloral hydrate, chloroform, diethyl ether, paraldehyde, sevoflurane)
|
---|
| Antagonists | |
---|
| NAMs |
- 1,3M1B
- 3M2B
- 17-Phenylandrostenol
- α5IA (LS-193,268)
- β-CCB
- β-CCE
- β-CCM
- β-CCP
- β-EMGBL
- Amiloride
- Anisatin
- β-Lactams (e.g., penicillins, cephalosporins, carbapenems)
- Basmisanil
- Bemegride
- Bilobalide
- CHEB
- Cicutoxin
- Cloflubicyne
- Cyclothiazide
- DHEA
- DHEA-S
- Dieldrin
- (+)-DMBB
- DMCM
- DMPC
- EBOB
- Etbicyphat
- FG-7142 (ZK-31906)
- Fiproles (e.g., fipronil)
- Flavonoids (e.g., amentoflavone, oroxylin A)
- Flumazenil
- Fluoroquinolones (e.g., ciprofloxacin)
- Flurothyl
- Furosemide
- Iomazenil (123I)
- Isoallopregnanolone
- Isopregnanolone (sepranolone)
- L-655,708
- Laudanosine
- Leptazol
- Lindane
- MaxiPost
- Morphine
- Morphine-3-glucuronide
- MRK-016
- Naloxone
- Naltrexone
- Nicardipine
- Non-steroidal antiandrogens (e.g., apalutamide, bicalutamide, enzalutamide, flutamide, nilutamide)
- Oenanthotoxin
- Pentetrazol (metrazol)
- Phenylsilatrane
- Picrotoxin (i.e., picrotin and picrotoxinin)
- Pregnenolone sulfate
- Propybicyphat
- PWZ-029
- Radequinil
- Ro 15-4513
- Ro 19-4603
- RO4882224
- RO4938581
- Sarmazenil
- SCS
- Suritozole
- TB-21007
- TBOB
- TBPS
- TCS-1105
- Terbequinil
- TETS
- Thujone
- U-93631
- Zinc
- ZK-93426
|
---|
|
---|
| | Agonists | |
---|
| PAMs | |
---|
| Antagonists | |
---|
| NAMs | |
---|
|
---|
| | Agonists | |
---|
| Antagonists | |
---|
| NAMs | |
---|
| PAMs | |
---|
|
---|
|
---|
| Transporter (blockers) | |
---|
| Enzyme (inhibitors) | |
---|
| Others | Precursors | |
---|
| Analogues | |
---|
| Others | |
---|
|
---|
| See also: GHBergics • Glutamatergics • Glycinergics |
|