Nupharin A
Nupharin A
 |
| Identifiers |
| |
81956-07-2 |
| Jmol interactive 3D |
Image |
| PubChem |
158198 |
C1=C(C=C(C(=C1O)O)O)C(=O)OCC2C3C(C(C(O2)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C(=C5)O)O)O)OC(=O)C6=CC(=C(C(=C6C7=C(C(=C(C=C7C(=O)O3)O)O)O)O)O)O
|
| Properties |
| |
C41H30O26 |
| Molar mass |
938.66 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
|
| Infobox references |
|
|
Nupharin A is an ellagitannin found in Nuphar japonica.[1] It is a molecule with three gallic acid units and one hexahydroxydiphenic acid unit attached to a glucose residue. It is an isomer of punicafolin and tellimagrandin II.
References
- ↑ Tannins and Related Compounds. LXXV. : Isolation and Characterization of Novel Diastereoisomeric Ellagitannins, Nupharins A and B, and Their Homologues from Nuphar japonicum DC. Chemical & pharmaceutical bulletin, 25 January 1989, volume 37, issue 1, pages 129-134 (abstract)
|
|---|
| | Moieties | |
|---|
| | Lactones | |
|---|
| | Monomers |
- Acetonyl geraniin
- Alnusiin
- Bicornin
- Carlesiin
- Casuarictin
- Emblicanin A and B
- Euscaphinin
- Galloyl pedunculagin
- Grandinin
- Helioscopinin B
- Jolkinin
- Lagerstannin A, B and C
- Macranganin
- Myrobalanitannin
- Nupharin A, B, C, D, E and F
- Pedunculagin
- Punicalagin
- Punigluconin
- Phyllanemblinin A, B, C, D, E and F
- Punicalin
- Roburin E
- Rugosin E
- Sanguiin H-5
- Stenophyllanin A, B and C
- Strictinin
- Tellimagrandin I and II
- Teracatain
- Terchebulin
- Terflavin A and B
- Tergallic acid
- Tergallic acid dilactone
C-glycosidic ellagitannins | |
|---|
| | |
|---|
| Transformed ellagitannins | | |
|---|
| molecules with Elaeocarpusinic acid |
- Elaeocarpusin
- Helioscopin B
- Mallojaponin (1-O-Galloyl-2,4-elaeocarpusinoyl-3,6-(R)-valoneayl-beta-D-glucose)
|
|---|
|
|---|
|
|---|
| | Oligomers | |
|---|
| | Other | |
|---|
|