Punicacortein B
Punicacortein B
 |
Names |
IUPAC name
(2R,3R)-3-[(14S,15S,19S)-2,3,4,7,8,9,19-Heptahydroxy-12,17-dioxo-13,16-dioxatetracyclo[13.3.1.05,18.06,11]nonadeca-1(18),2,4,6,8,10-hexaen-14-yl]-2,3-dihydroxypropyl 3,4,5-trihydroxybenzoate |
Identifiers |
ChemSpider |
16738326 |
Jmol interactive 3D |
Image |
Key: 1S/C27H22O18/c28-7-1-5(2-8(29)15(7)32)25(40)43-4-10(31)17(34)23-24-21(38)14-13(27(42)45-24)12(19(36)22(39)20(14)37)11-6(26(41)44-23)3-9(30)16(33)18(11)35/h1-3,10,17,21,23-24,28-39H,4H2/t10-,17-,21+,23+,24+/m1/s1 Key: JYPJJOONMBTTAR-MEZSAOBOSA-N
|
Oc1cc(cc(O)c1O)C(=O)OC[C@@H](O)[C@@H](O)[C@@H]5OC(=O)c2cc(O)c(O)c(O)c2c3c(O)c(O)c(O)c4[C@H](O)[C@@H]5OC(=O)c34
|
Properties |
|
C27H22O18 |
Molar mass |
634.43 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Infobox references |
|
|
Punicacortein B is an ellagitannin, a polyphenol compound. It is found in the bark of Punica granatum (pomegranate).[1]
References
- ↑ Tannins and Related Compounds. XLI. : Isolation and Characterization of Novel Ellagitannins, Punicacorteins A, B, C, and D, and Punigluconin from the Bark of Punica granatum L. Tanaka Takashi, Nonaka Gen-Ichiro and Nishioka Itsuo, Chemical & pharmaceutical bulletin, 1986-02-25, 34(2), pages 656-663 (abstract)
|
---|
| Moieties | |
---|
| Lactones | |
---|
| Monomers |
- Acetonyl geraniin
- Alnusiin
- Bicornin
- Carlesiin
- Casuarictin
- Emblicanin A and B
- Euscaphinin
- Galloyl pedunculagin
- Grandinin
- Helioscopinin B
- Jolkinin
- Lagerstannin A, B and C
- Macranganin
- Myrobalanitannin
- Nupharin A, B, C, D, E and F
- Pedunculagin
- Punicalagin
- Punigluconin
- Phyllanemblinin A, B, C, D, E and F
- Punicalin
- Roburin E
- Rugosin E
- Sanguiin H-5
- Stenophyllanin A, B and C
- Strictinin
- Tellimagrandin I and II
- Teracatain
- Terchebulin
- Terflavin A and B
- Tergallic acid
- Tergallic acid dilactone
C-glycosidic ellagitannins | |
---|
| | |
---|
| Transformed ellagitannins | | |
---|
| molecules with Elaeocarpusinic acid |
- Elaeocarpusin
- Helioscopin B
- Mallojaponin (1-O-Galloyl-2,4-elaeocarpusinoyl-3,6-(R)-valoneayl-beta-D-glucose)
|
---|
|
---|
|
---|
| Oligomers | |
---|
| Other | |
---|
|