Amurensin (flavonol)
      
Amurensin
 
|  | 
|  | 
| Names | 
| IUPAC name 3,5-dihydroxy-8-(3-hydroxy-3-methylbutyl)-2-(4-hydroxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one | 
| Identifiers | 
|  | 641-94-1  N | 
| ChemSpider | 20120043  N | 
| Jmol interactive 3D | Image | 
| PubChem | 5318156 | 
| 
InChI=1S/C26H30O12/c1-26(2,35)8-7-13-15(36-25-22(34)20(32)18(30)16(10-27)37-25)9-14(29)17-19(31)21(33)23(38-24(13)17)11-3-5-12(28)6-4-11/h3-6,9,16,18,20,22,25,27-30,32-35H,7-8,10H2,1-2H3/t16-,18-,20+,22-,25-/m1/s1  NKey: UNHHWEHQUUGKEE-MLLLWRCASA-N  NInChI=1/C26H30O12/c1-26(2,35)8-7-13-15(36-25-22(34)20(32)18(30)16(10-27)37-25)9-14(29)17-19(31)21(33)23(38-24(13)17)11-3-5-12(28)6-4-11/h3-6,9,16,18,20,22,25,27-30,32-35H,7-8,10H2,1-2H3/t16-,18-,20+,22-,25-/m1/s1 Key: UNHHWEHQUUGKEE-MLLLWRCABA
 | 
| 
CC(C)(CCC1=C(C=C(C2=C1OC(=C(C2=O)O)C3=CC=C(C=C3)O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O
 | 
| Properties | 
|  | C26H30O12 | 
| Molar mass | 534.50 g/mol | 
| Density | 1.581 g/mL | 
| Except where otherwise noted, data are given for materials in their standard state  (at 25 °C [77 °F], 100 kPa). | 
|  N verify (what is  Y  N ?) | 
| Infobox references | 
|  |  | 
Amurensin is a flavonol, a type of flavonoid. It is the tert-amyl alcohol derivative of kaempferol 7-O-glucoside. It can be found in Phellodendron amurense.[1]
 
 Related compounds 
6"'-O-acetyl amurensin is found in the leaves of Phellodendron japonicum.[2]
 References 
- ↑  Two New Flavonoid Glycosides from the Leaves of Phellodendron amurense Ruprecht. Masao Hasegawa and Teruo Shirato, J. Am. Chem. Soc., 1953, 75 (22), pages 5507–5511, doi:10.1021/ja01118a013
- ↑  Constituents of Leaves of Phellodendron japonicum MAXIM. and Their Antioxidant Activity, Chih-Yang Chiu, Chia-Ying Li, Chao-Chen Chiu, Masatake Niwa, Susumu Kitanaka, Amooru Gangaiah Damu, E-Jian Lee and Tian-Shung Wu, Chem. Pharm. Bull., Vol. 53, pages 1118-1121 (2005), doi:10.1248/cpb.53.1118
 
| | Flavonols and their conjugates | 
|---|
 |  |  | Backbone |  | 
|---|
 |  |  | Flavonols | | Aglycones |  | 
|---|
 |  |  | Conjugates | |  |  | 
|---|
 |  |  |  | 
 Afzelin (Kaempferol 3-rhamnoside)  Astragalin (kaempferol 3-O-glucoside)  Kaempferitrin (kaempferol 3,7-dirhamnoside)  Juglanin (Kaempferol 3-O-arabinoside)  Kaempferol 3-alpha-L-arabinopyranoside  Kaempferol 3-alpha-D-arabinopyranoside  Kaempferol 7-alpha-L-arabinoside  Kaempferol 7-O-glucoside  Kaempferol 3-lathyroside  Kaempferol 4'-rhamnoside  Kaempferol 5-rhamnoside  Kaempferol 7-rhamnoside  Kaempferol 7-O-alpha-L-rhamnofuranoside  Kaempferol 3-xyloside  Kaempferol 7-xyloside  Robinin (kaempferol-3-O-robinoside-7-O-rhamnoside)  Kaempferol 3-O-rutinoside  Sophoraflavonoloside (Kaempferol 3-O-sophoroside)  Trifolin (Kaempferol 3-O-beta-D-galactoside)
 | 
|---|
 |  |  |  |  | 
|---|
 |  |  |  |  | 
|---|
 | 
|---|
 | 
|---|
 |  |  | O-Methylated flavonols | | Aglycones |  | 
|---|
 |  |  | Glycosides | | of isorhamnetin | 
 Narcissin (Isorhamnetin 3-O-rutinoside) Isorhamnetin 3-O-glucoside  Tamarixetin 7-rutinoside
 | 
|---|
 |  |  | other | 
 Azalein (Azaleatin 3-O-α-L-rhamnoside)  Centaurein (Centaureidin 7-O-glucoside) Eupalin (Eupalitin 3-0-rhamnoside)  Eupatolin (Eupatolitin 3-O-rhamnoside)  Jacein (Jaceidin 7-O-glucoside) Patulitrin (Patuletin 7-O-glucoside Xanthorhamnin (Rhamnetin glycoside)
 | 
|---|
 | 
|---|
 | 
|---|
 |  |  | Derivative flavonols | | Aglycones | 
 Noricaritin  Dihydronoricaritin
 | 
|---|
 |  |  | Glycosides |  | 
|---|
 | 
|---|
 |  |  | Pyranoflavonols |  | 
|---|
 |  |  | Furanoflavonols |  | 
|---|
 |  |  | Semisynthetic |  | 
|---|
 |