Rhodionin
      
Rhodionin
 
|  | 
| Names | 
| IUPAC name 3,5,8-Trihydroxy-2-(4-hydroxyphenyl)-7-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one | 
| Other names Herbacetin-7-O-α-L-rhamnopyranosideHerbacetin 7-rhamnoside
 | 
| Identifiers | 
|  | 85571-15-9  Y | 
| ChemSpider | 10252127 | 
| Jmol interactive 3D | Image | 
| PubChem | 46226584 | 
| 
InChI=1S/C21H20O11/c1-7-13(24)16(27)18(29)21(30-7)31-11-6-10(23)12-15(26)17(28)19(32-20(12)14(11)25)8-2-4-9(22)5-3-8/h2-7,13,16,18,21-25,27-29H,1H3/t7-,13-,16+,18+,21-/m0/s1 Key: CIAXXTSXVCLEJK-JOEVVYSCSA-NInChI=1/C21H20O11/c1-7-13(24)16(27)18(29)21(30-7)31-11-6-10(23)12-15(26)17(28)19(32-20(12)14(11)25)8-2-4-9(22)5-3-8/h2-7,13,16,18,21-25,27-29H,1H3/t7-,13-,16+,18+,21-/m0/s1 Key: CIAXXTSXVCLEJK-JOEVVYSCBK
 | 
| 
Oc1ccc(cc1)C=3Oc4c(O)c(O[C@@H]2O[C@@H](C)[C@H](O)[C@@H](O)[C@H]2O)cc(O)c4C(=O)C=3O
 | 
| Properties | 
|  | C21H20O11 | 
| Molar mass | 448.38 g·mol−1 | 
| Except where otherwise noted, data are given for materials in their standard state  (at 25 °C [77 °F], 100 kPa). | 
|
| Infobox references | 
|  |  | 
Rhodionin is a herbacetin rhamnoside found in Rhodiola species.[1]
 References 
- ↑  Li, T.; Zhang, H. (2008). "Identification and Comparative Determination of Rhodionin in Traditional Tibetan Medicinal Plants of Fourteen Rhodiola Species by High-Performance Liquid Chromatography-Photodiode Array Detection and Electrospray Ionization-Mass Spectrometry". Chemical & Pharmaceutical Bulletin 56 (6): 807–14. doi:10.1248/cpb.56.807. PMID 18520085. 
 
| | Flavonols and their conjugates | 
|---|
 |  |  | Backbone |  | 
|---|
 |  |  | Flavonols | | Aglycones |  | 
|---|
 |  |  | Conjugates | |  |  | 
|---|
 |  |  |  | 
 Afzelin (Kaempferol 3-rhamnoside)  Astragalin (kaempferol 3-O-glucoside)  Kaempferitrin (kaempferol 3,7-dirhamnoside)  Juglanin (Kaempferol 3-O-arabinoside)  Kaempferol 3-alpha-L-arabinopyranoside  Kaempferol 3-alpha-D-arabinopyranoside  Kaempferol 7-alpha-L-arabinoside  Kaempferol 7-O-glucoside  Kaempferol 3-lathyroside  Kaempferol 4'-rhamnoside  Kaempferol 5-rhamnoside  Kaempferol 7-rhamnoside  Kaempferol 7-O-alpha-L-rhamnofuranoside  Kaempferol 3-xyloside  Kaempferol 7-xyloside  Robinin (kaempferol-3-O-robinoside-7-O-rhamnoside)  Kaempferol 3-O-rutinoside  Sophoraflavonoloside (Kaempferol 3-O-sophoroside)  Trifolin (Kaempferol 3-O-beta-D-galactoside)
 | 
|---|
 |  |  |  |  | 
|---|
 |  |  |  |  | 
|---|
 | 
|---|
 | 
|---|
 |  |  | O-Methylated flavonols | | Aglycones |  | 
|---|
 |  |  | Glycosides | | of isorhamnetin | 
 Narcissin (Isorhamnetin 3-O-rutinoside) Isorhamnetin 3-O-glucoside  Tamarixetin 7-rutinoside
 | 
|---|
 |  |  | other | 
 Azalein (Azaleatin 3-O-α-L-rhamnoside)  Centaurein (Centaureidin 7-O-glucoside) Eupalin (Eupalitin 3-0-rhamnoside)  Eupatolin (Eupatolitin 3-O-rhamnoside)  Jacein (Jaceidin 7-O-glucoside) Patulitrin (Patuletin 7-O-glucoside Xanthorhamnin (Rhamnetin glycoside)
 | 
|---|
 | 
|---|
 | 
|---|
 |  |  | Derivative flavonols | | Aglycones | 
 Noricaritin  Dihydronoricaritin
 | 
|---|
 |  |  | Glycosides |  | 
|---|
 | 
|---|
 |  |  | Pyranoflavonols |  | 
|---|
 |  |  | Furanoflavonols |  | 
|---|
 |  |  | Semisynthetic |  | 
|---|
 |