Annulatin
Annulatin
 |
| Names |
| Other names
Myricetin 3-Methylether 3',4',5,5',7-Pentahydroxy-3-methoxyflavone |
| Identifiers |
| |
1486-67-5 Y |
| ChemSpider |
24227213 Y |
| Jmol interactive 3D |
Image |
InChI=1S/C16H12O8/c1-23-16-14(22)12-8(18)4-7(17)5-11(12)24-15(16)6-2-9(19)13(21)10(20)3-6/h2-5,17-21H,1H3 YKey: XWTLYULBWZQAAZ-UHFFFAOYSA-N YInChI=1/C16H12O8/c1-23-16-14(22)12-8(18)4-7(17)5-11(12)24-15(16)6-2-9(19)13(21)10(20)3-6/h2-5,17-21H,1H3 Key: XWTLYULBWZQAAZ-UHFFFAOYAS
|
COc1c(=O)c2c(cc(cc2oc1c3cc(c(c(c3)O)O)O)O)O
|
| Properties |
| |
C16H12O8 |
| Molar mass |
332.25 g/mol |
| Density |
1.807 g/mL |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Y verify (what is Y N ?) |
| Infobox references |
|
|
Annulatin is an O-methylated flavonol found in the roots of Pteroxygonum giraldii.[1]
References
- ↑ Antioxidant Flavone Glycosides from the Root of Pteroxygonum giraldii. Bao-Lin Li, Zhan-Jun Yang, Lin-Ling Jiang, Xi-Quan Zhang, Hong-Mei Gu, Hui-Chun Wang and Xian-Hua Tian, Bull. Korean Chem. Soc. 2009, Vol. 30, No. 7, pp. 1459-1462, doi:10.1002/chin.200949203
Flavonols and their conjugates |
|---|
| | Backbone | |
|---|
| | Flavonols | Aglycones | |
|---|
| Conjugates | | |
|---|
| |
- Afzelin (Kaempferol 3-rhamnoside)
- Astragalin (kaempferol 3-O-glucoside)
- Kaempferitrin (kaempferol 3,7-dirhamnoside)
- Juglanin (Kaempferol 3-O-arabinoside)
- Kaempferol 3-alpha-L-arabinopyranoside
- Kaempferol 3-alpha-D-arabinopyranoside
- Kaempferol 7-alpha-L-arabinoside
- Kaempferol 7-O-glucoside
- Kaempferol 3-lathyroside
- Kaempferol 4'-rhamnoside
- Kaempferol 5-rhamnoside
- Kaempferol 7-rhamnoside
- Kaempferol 7-O-alpha-L-rhamnofuranoside
- Kaempferol 3-xyloside
- Kaempferol 7-xyloside
- Robinin (kaempferol-3-O-robinoside-7-O-rhamnoside)
- Kaempferol 3-O-rutinoside
- Sophoraflavonoloside (Kaempferol 3-O-sophoroside)
- Trifolin (Kaempferol 3-O-beta-D-galactoside)
|
|---|
| | |
|---|
| | |
|---|
|
|---|
|
|---|
| | O-Methylated flavonols | Aglycones | |
|---|
| Glycosides | of isorhamnetin |
- Narcissin (Isorhamnetin 3-O-rutinoside)
- Isorhamnetin 3-O-glucoside
- Tamarixetin 7-rutinoside
|
|---|
| other |
- Azalein (Azaleatin 3-O-α-L-rhamnoside)
- Centaurein (Centaureidin 7-O-glucoside)
- Eupalin (Eupalitin 3-0-rhamnoside)
- Eupatolin (Eupatolitin 3-O-rhamnoside)
- Jacein (Jaceidin 7-O-glucoside)
- Patulitrin (Patuletin 7-O-glucoside
- Xanthorhamnin (Rhamnetin glycoside)
|
|---|
|
|---|
|
|---|
| | Derivative flavonols | Aglycones |
- Noricaritin
- Dihydronoricaritin
|
|---|
| Glycosides | |
|---|
|
|---|
| | Pyranoflavonols | |
|---|
| | Furanoflavonols | |
|---|
| | Semisynthetic | |
|---|
|