Kaempferide
Kaempferide
 |
| Names |
| IUPAC name
3,5,7-trihydroxy-2-(4-methoxyphenyl)chromen-4-one |
| Other names
Kaempferid 4'-Methylkaempferol Kaempferol 4'-methyl ether 4'-O-Methylkaempferol |
| Identifiers |
| |
491-54-3 Y |
| ChEBI |
CHEBI:6099 N |
| ChEMBL |
ChEMBL40919 N |
| ChemSpider |
4444985 N |
| Jmol interactive 3D |
Image Image |
| PubChem |
5281666 |
InChI=1S/C16H12O6/c1-21-10-4-2-8(3-5-10)16-15(20)14(19)13-11(18)6-9(17)7-12(13)22-16/h2-7,17-18,20H,1H3 NKey: SQFSKOYWJBQGKQ-UHFFFAOYSA-N NInChI=1/C16H12O6/c1-21-10-4-2-8(3-5-10)16-15(20)14(19)13-11(18)6-9(17)7-12(13)22-16/h2-7,17-18,20H,1H3 Key: SQFSKOYWJBQGKQ-UHFFFAOYAC
|
COC1=CC=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O COC1=CC=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O
|
| Properties |
| |
C16H12O6 |
| Molar mass |
300.26 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
N verify (what is Y N ?) |
| Infobox references |
|
|
Kaempferide is an O-methylated flavonol, a type of chemical compound. It can be found in Kaempferia galanga (aromatic ginger).
Metabolism
The enzyme kaempferol 4'-O-methyltransferase uses S-adenosyl-L-methionine and kaempferol to produce S-adenosyl-L-homocysteine and kaempferide.
Glycosides
Icariin is the tert-amyl alcohol derivative of kaempferide 3,7-O-diglycoside.
External links
Flavonols and their conjugates |
|---|
| | Backbone | |
|---|
| | Flavonols | Aglycones | |
|---|
| Conjugates | | |
|---|
| |
- Afzelin (Kaempferol 3-rhamnoside)
- Astragalin (kaempferol 3-O-glucoside)
- Kaempferitrin (kaempferol 3,7-dirhamnoside)
- Juglanin (Kaempferol 3-O-arabinoside)
- Kaempferol 3-alpha-L-arabinopyranoside
- Kaempferol 3-alpha-D-arabinopyranoside
- Kaempferol 7-alpha-L-arabinoside
- Kaempferol 7-O-glucoside
- Kaempferol 3-lathyroside
- Kaempferol 4'-rhamnoside
- Kaempferol 5-rhamnoside
- Kaempferol 7-rhamnoside
- Kaempferol 7-O-alpha-L-rhamnofuranoside
- Kaempferol 3-xyloside
- Kaempferol 7-xyloside
- Robinin (kaempferol-3-O-robinoside-7-O-rhamnoside)
- Kaempferol 3-O-rutinoside
- Sophoraflavonoloside (Kaempferol 3-O-sophoroside)
- Trifolin (Kaempferol 3-O-beta-D-galactoside)
|
|---|
| | |
|---|
| | |
|---|
|
|---|
|
|---|
| | O-Methylated flavonols | Aglycones | |
|---|
| Glycosides | of isorhamnetin |
- Narcissin (Isorhamnetin 3-O-rutinoside)
- Isorhamnetin 3-O-glucoside
- Tamarixetin 7-rutinoside
|
|---|
| other |
- Azalein (Azaleatin 3-O-α-L-rhamnoside)
- Centaurein (Centaureidin 7-O-glucoside)
- Eupalin (Eupalitin 3-0-rhamnoside)
- Eupatolin (Eupatolitin 3-O-rhamnoside)
- Jacein (Jaceidin 7-O-glucoside)
- Patulitrin (Patuletin 7-O-glucoside
- Xanthorhamnin (Rhamnetin glycoside)
|
|---|
|
|---|
|
|---|
| | Derivative flavonols | Aglycones |
- Noricaritin
- Dihydronoricaritin
|
|---|
| Glycosides | |
|---|
|
|---|
| | Pyranoflavonols | |
|---|
| | Furanoflavonols | |
|---|
| | Semisynthetic | |
|---|
|