Monoxerutin
Monoxerutin
|
Systematic (IUPAC) name |
---|
2-(3,4-dihydroxyphenyl)-5-hydroxy-7-(2-hydroxyethoxy)-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one |
Identifiers |
---|
CAS Number |
23869-24-1 Y |
---|
ATC code |
C05CA02 (WHO) |
---|
PubChem |
CID 9852585 |
---|
ChemSpider |
8028296 |
---|
UNII |
EKF7043SBU Y |
---|
KEGG |
D07179 Y |
---|
Synonyms |
Rutilemone Varemoid Paroven Relvene Monoxerutinum Monoxerutina Monoxerutine |
---|
Chemical data |
---|
Formula |
C29H34O17 |
---|
Molar mass |
654.57 g/mol |
---|
C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)OCCO)C5=CC(=C(C=C5)O)O)O)O)O)O)O)O
|
InChI=1S/C29H34O17/c1-10-19(34)22(37)24(39)28(43-10)42-9-17-20(35)23(38)25(40)29(45-17)46-27-21(36)18-15(33)7-12(41-5-4-30)8-16(18)44-26(27)11-2-3-13(31)14(32)6-11/h2-3,6-8,10,17,19-20,22-25,28-35,37-40H,4-5,9H2,1H3/t10-,17+,19-,20+,22+,23-,24+,25+,28+,29-/m0/s1 Key:MBHXKZDTQCSVPM-BDAFLREQSA-N
|
(verify) |
---|
Monoxerutin is a flavonol, a type of flavonoid. It is more accurately a hydroxyethylrutoside.[1]
References
- ↑ Hager, H (1994). Hagers Handbuch der pharmazeutischen Praxis (in German). 8: Stoffe E–O (5th ed.). Springer. ISBN 3-540-52640-4.
Flavonols and their conjugates |
---|
| Backbone | |
---|
| Flavonols | Aglycones | |
---|
| Conjugates | | |
---|
| |
- Afzelin (Kaempferol 3-rhamnoside)
- Astragalin (kaempferol 3-O-glucoside)
- Kaempferitrin (kaempferol 3,7-dirhamnoside)
- Juglanin (Kaempferol 3-O-arabinoside)
- Kaempferol 3-alpha-L-arabinopyranoside
- Kaempferol 3-alpha-D-arabinopyranoside
- Kaempferol 7-alpha-L-arabinoside
- Kaempferol 7-O-glucoside
- Kaempferol 3-lathyroside
- Kaempferol 4'-rhamnoside
- Kaempferol 5-rhamnoside
- Kaempferol 7-rhamnoside
- Kaempferol 7-O-alpha-L-rhamnofuranoside
- Kaempferol 3-xyloside
- Kaempferol 7-xyloside
- Robinin (kaempferol-3-O-robinoside-7-O-rhamnoside)
- Kaempferol 3-O-rutinoside
- Sophoraflavonoloside (Kaempferol 3-O-sophoroside)
- Trifolin (Kaempferol 3-O-beta-D-galactoside)
|
---|
| | |
---|
| | |
---|
|
---|
|
---|
| O-Methylated flavonols | Aglycones | |
---|
| Glycosides | of isorhamnetin |
- Narcissin (Isorhamnetin 3-O-rutinoside)
- Isorhamnetin 3-O-glucoside
- Tamarixetin 7-rutinoside
|
---|
| other |
- Azalein (Azaleatin 3-O-α-L-rhamnoside)
- Centaurein (Centaureidin 7-O-glucoside)
- Eupalin (Eupalitin 3-0-rhamnoside)
- Eupatolin (Eupatolitin 3-O-rhamnoside)
- Jacein (Jaceidin 7-O-glucoside)
- Patulitrin (Patuletin 7-O-glucoside
- Xanthorhamnin (Rhamnetin glycoside)
|
---|
|
---|
|
---|
| Derivative flavonols | Aglycones |
- Noricaritin
- Dihydronoricaritin
|
---|
| Glycosides | |
---|
|
---|
| Pyranoflavonols | |
---|
| Furanoflavonols | |
---|
| Semisynthetic | |
---|
|