Meciadanol
Meciadanol
 |
| Names |
| IUPAC name
2-(3,4-dihydroxyphenyl)-3-methoxy-3,4-dihydro-2H-chromene-5,7-diol |
| Other names
3-O-methylcatechin Meciadanolum 3',4',5,7-Tetrahydroxy-3-methoxyflavan (2R,3S)-2-(3,4-Dihydroxyphenyl)-3-methoxy-5,7-chromandiol |
| Identifiers |
| |
65350-86-9 Y 87367-19-9 N |
| ChemSpider |
8555738 N |
| Jmol interactive 3D |
Image |
| PubChem |
10380295 |
| UNII |
2H64SE2UXS Y |
InChI=1S/C16H16O6/c1-21-15-7-10-12(19)5-9(17)6-14(10)22-16(15)8-2-3-11(18)13(20)4-8/h2-6,15-20H,7H2,1H3/t15-,16+/m0/s1 NKey: PDHSAQOQVUXZGQ-JKSUJKDBSA-N NInChI=1/C16H16O6/c1-21-15-7-10-12(19)5-9(17)6-14(10)22-16(15)8-2-3-11(18)13(20)4-8/h2-6,15-20H,7H2,1H3/t15-,16+/m0/s1 Key: PDHSAQOQVUXZGQ-JKSUJKDBBQ
|
CO[C@H]1CC2=C(C=C(C=C2O[C@@H]1C3=CC(=C(C=C3)O)O)O)O
|
| Properties |
| |
C16H16O6 |
| Molar mass |
304.29 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
N verify (what is Y N ?) |
| Infobox references |
|
|
Meciadanol is a synthetic O-methylated flavanol. It is the 3-O-methylation of catechin.
It inhibits the histidine decarboxylase in rats.[1]
References
- ↑ Gastric protection by meciadanol. A new synthetic flavonoid-inhibiting histidine decarboxylase. Stanislaw J. Konturek, Mary Ellen Kitler, Tomasz Brzozowski and Tadeusz Radecki, Digestive Diseases and Sciences, Volume 31, Number 8 / 1986, Pages 847-852, doi:10.1007/BF01296054
|
|---|
| | Flavan-3-ols | |
|---|
| | O-methylated flavan-3ols |
- Meciadanol (3-O-methylcatechin)
- Ourateacatechin (4′-O-methyl-(−)-epigallocatechin)
|
|---|
| | Glycosides |
- Arthromerin A (Afzelechin-3-O-β-D-xylopyranoside)
- Arthromerin B (Afzelechin-3-O-β-D-glucopyranoside)
- Catechin-3-O-glucoside
- Catechin-3'-O-glucoside
- Catechin-4'-O-glucoside
- Catechin-5-O-glucoside
- Catechin-7-O-glucoside
- (+)-Catechin 7-O-β-D-xylopyranoside
- Epicatechin-3′-O-glucoside
- Glochiflavanoside A, B, C D
- Polydine ((+)-catechin 7-0-α-L-arabinoside)
- Symplocoside (3’-O-methyl-(-)-epicatechin 7-O-β-D-glucopyranoside)
|
|---|
| | Acetylated | |
|---|
| | Misc. | |
|---|
|
|
|---|
| Receptor (ligands) | | H1 |
- Non-generational: Atypical antipsychotics (e.g., aripiprazole, asenapine, clozapine, iloperidone, olanzapine, paliperidone, quetiapine, risperidone, ziprasidone, zotepine)
- Tetracyclic antidepressants (e.g., amoxapine, loxapine, maprotiline, mianserin, mirtazapine, oxaprotiline)
- Tricyclic antidepressants (e.g., amitriptyline, butriptyline, clomipramine, desipramine, dosulepin (dothiepin), doxepin, imipramine, iprindole, lofepramine, nortriptyline, protriptyline, trimipramine)
- Typical antipsychotics (e.g., chlorpromazine, flupenthixol, fluphenazine, loxapine, perphenazine, prochlorperazine, thioridazine, thiothixene)
- Unknown/unsorted: Belarizine
- Elbanizine
- Flotrenizine
- Napactadine
- Tagorizine
- Trelnarizine
- Trenizine
|
|---|
| | H2 | |
|---|
| | H3 | |
|---|
| | H4 | |
|---|
|
|---|
| Transporter (inhibitors) | |
|---|
| Enzyme (inhibitors) | |
|---|
| | Others | |
|---|
|