Rhamnazin
Rhamnazin
 |
| Names |
| IUPAC name
3,5-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-methoxychromen-4-one |
| Other names
3',7-Dimethylquercetin 3,5,4'-Trihydroxy-7,3'-dimethoxyflavone 5,3',4'-trihydroxy-3,7-dimethoxyflavone |
| Identifiers |
| |
552-54-5 Y |
| ChEMBL |
ChEMBL457148 N |
| ChemSpider |
4478873 N |
| Jmol interactive 3D |
Image |
| PubChem |
5320945 |
InChI=1S/C17H14O7/c1-22-9-6-11(19)14-13(7-9)24-17(16(21)15(14)20)8-3-4-10(18)12(5-8)23-2/h3-7,18-19,21H,1-2H3 NKey: MYMGKIQXYXSRIJ-UHFFFAOYSA-N NInChI=1/C17H14O7/c1-22-9-6-11(19)14-13(7-9)24-17(16(21)15(14)20)8-3-4-10(18)12(5-8)23-2/h3-7,18-19,21H,1-2H3 Key: MYMGKIQXYXSRIJ-UHFFFAOYAP
|
COC1=CC(=C2C(=C1)OC(=C(C2=O)O)C3=CC(=C(C=C3)O)OC)O
|
| Properties |
| |
C17H14O7 |
| Molar mass |
330.29 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
N verify (what is Y N ?) |
| Infobox references |
|
|
Rhamnazin is an O-methylated flavonol, a type of chemical compound. It can be found in Rhamnus petiolaris,[1] a buckthorn plant endemic to Sri Lanka.
Metabolism
The enzyme 3-methylquercetin 7-O-methyltransferase uses S-adenosyl methionine and isorhamnetin to produce S-adenosylhomocysteine and rhamnazin.
The enzyme 3,7-dimethylquercetin 4'-O-methyltransferase uses S-adenosyl methionine and rhamnazin to produce S-adenosylhomocysteine and ayanin.
External links
References
- ↑ Rhamnazin- und rhamnetin-3-O-trioside aus Rhamnus petiolaris. H. Wagner, M. Ertan and O. Seligmann, Phytochemistry, Volume 13, Issue 5, May 1974, pp. 857-860, doi:10.1016/S0031-9422(00)91151-8
Flavonols and their conjugates |
|---|
| | Backbone | |
|---|
| | Flavonols | Aglycones | |
|---|
| Conjugates | | |
|---|
| |
- Afzelin (Kaempferol 3-rhamnoside)
- Astragalin (kaempferol 3-O-glucoside)
- Kaempferitrin (kaempferol 3,7-dirhamnoside)
- Juglanin (Kaempferol 3-O-arabinoside)
- Kaempferol 3-alpha-L-arabinopyranoside
- Kaempferol 3-alpha-D-arabinopyranoside
- Kaempferol 7-alpha-L-arabinoside
- Kaempferol 7-O-glucoside
- Kaempferol 3-lathyroside
- Kaempferol 4'-rhamnoside
- Kaempferol 5-rhamnoside
- Kaempferol 7-rhamnoside
- Kaempferol 7-O-alpha-L-rhamnofuranoside
- Kaempferol 3-xyloside
- Kaempferol 7-xyloside
- Robinin (kaempferol-3-O-robinoside-7-O-rhamnoside)
- Kaempferol 3-O-rutinoside
- Sophoraflavonoloside (Kaempferol 3-O-sophoroside)
- Trifolin (Kaempferol 3-O-beta-D-galactoside)
|
|---|
| | |
|---|
| | |
|---|
|
|---|
|
|---|
| | O-Methylated flavonols | Aglycones | |
|---|
| Glycosides | of isorhamnetin |
- Narcissin (Isorhamnetin 3-O-rutinoside)
- Isorhamnetin 3-O-glucoside
- Tamarixetin 7-rutinoside
|
|---|
| other |
- Azalein (Azaleatin 3-O-α-L-rhamnoside)
- Centaurein (Centaureidin 7-O-glucoside)
- Eupalin (Eupalitin 3-0-rhamnoside)
- Eupatolin (Eupatolitin 3-O-rhamnoside)
- Jacein (Jaceidin 7-O-glucoside)
- Patulitrin (Patuletin 7-O-glucoside
- Xanthorhamnin (Rhamnetin glycoside)
|
|---|
|
|---|
|
|---|
| | Derivative flavonols | Aglycones |
- Noricaritin
- Dihydronoricaritin
|
|---|
| Glycosides | |
|---|
|
|---|
| | Pyranoflavonols | |
|---|
| | Furanoflavonols | |
|---|
| | Semisynthetic | |
|---|
|