Astragalin
      
Astragalin
 
   | 
| Names | 
|  IUPAC name
 5,7-dihydroxy-2-(4-hydroxyphenyl)-3-[(2S,3R,4S,5S,6R)-3,4,
5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one  | 
|  Other names
 Astragaline asragalin kaempferol-3-glucoside Kaempferol 3-glucoside Kaempferol 3-O-glucoside Kaempferol-3-O-glucoside Kaempferol-3-D-glucoside Kaempferol-3-beta-monoglucoside Kaempferol 3-O-β-D-glucopyranoside  | 
| Identifiers | 
|   | 
 480-10-4  N | 
|   | 
 100568 | 
|  ChEBI | 
 CHEBI:30200  Y | 
|  ChEMBL | 
 ChEMBL453290  N | 
|  ChemSpider | 
 4445311  Y | 
|  Jmol interactive 3D | 
 Image | 
|  PubChem | 
 5282102 | 
 
InChI=1S/C21H20O11/c22-7-13-15(26)17(28)18(29)21(31-13)32-20-16(27)14-11(25)5-10(24)6-12(14)30-19(20)8-1-3-9(23)4-2-8/h1-6,13,15,17-18,21-26,28-29H,7H2/t13-,15-,17+,18-,21+/m1/s1   YKey:  JPUKWEQWGBDDQB-QSOFNFLRSA-N   YInChI=1/C21H20O11/c22-7-13-15(26)17(28)18(29)21(31-13)32-20-16(27)14-11(25)5-10(24)6-12(14)30-19(20)8-1-3-9(23)4-2-8/h1-6,13,15,17-18,21-26,28-29H,7H2/t13-,15-,17+,18-,21+/m1/s1 Key: JPUKWEQWGBDDQB-QSOFNFLRBV  
  | 
 
O=C2C(\O[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO)=C(/Oc3cc(O)cc(O)c23)c4ccc(O)cc4  
  | 
| Properties | 
|   | 
 C21H20O11 | 
|  Molar mass | 
 448.37 g/mol   | 
|  Density | 
 1.791 g/mL | 
 Except where otherwise noted, data are given for materials in their  standard state (at 25  °C [77  °F], 100  kPa).  | 
  N verify (what is  Y N ?) | 
|  Infobox references | 
 | 
 | 
Astragalin is a chemical compound. It can be isolated from Phytolacca americana (the American pokeweed) or in the methanolic extract of fronds of the fern Phegopteris connectilis.[1]  It is also found in wine.
Astragalin is a 3-O-glucoside of kaempferol.
 References 
- ↑  Phenolic constituents of the fernPhegopteris connectilis. Klaus-Peter Adam, Phytochemistry, Volume 52, Issue 5, November 1999, Pages 929–934, doi:10.1016/S0031-9422(99)00326-X
 
 
Flavonols and their conjugates  | 
|---|
  |  | Backbone |  | 
|---|
  |  | Flavonols | Aglycones  |  | 
|---|
  |  Conjugates  |  |  | 
|---|
  |   | 
-  Afzelin (Kaempferol 3-rhamnoside) 
 
-  Astragalin (kaempferol 3-O-glucoside) 
 
-  Kaempferitrin (kaempferol 3,7-dirhamnoside) 
 
-  Juglanin (Kaempferol 3-O-arabinoside) 
 
-  Kaempferol 3-alpha-L-arabinopyranoside 
 
-  Kaempferol 3-alpha-D-arabinopyranoside 
 
-  Kaempferol 7-alpha-L-arabinoside 
 
-  Kaempferol 7-O-glucoside 
 
-  Kaempferol 3-lathyroside 
 
-  Kaempferol 4'-rhamnoside 
 
-  Kaempferol 5-rhamnoside 
 
-  Kaempferol 7-rhamnoside 
 
-  Kaempferol 7-O-alpha-L-rhamnofuranoside 
 
-  Kaempferol 3-xyloside 
 
-  Kaempferol 7-xyloside 
 
-  Robinin (kaempferol-3-O-robinoside-7-O-rhamnoside) 
 
-  Kaempferol 3-O-rutinoside 
 
-  Sophoraflavonoloside (Kaempferol 3-O-sophoroside) 
 
-  Trifolin (Kaempferol 3-O-beta-D-galactoside)
  
  | 
|---|
  |   |  | 
|---|
  |   |  | 
|---|
 
  | 
|---|
 
  | 
|---|
  |  | O-Methylated flavonols | Aglycones  |  | 
|---|
  |  Glycosides  | of isorhamnetin  | 
-  Narcissin (Isorhamnetin 3-O-rutinoside)
 
-  Isorhamnetin 3-O-glucoside 
 
-  Tamarixetin 7-rutinoside
  
  | 
|---|
  |  other  | 
-  Azalein (Azaleatin 3-O-α-L-rhamnoside) 
 
-  Centaurein (Centaureidin 7-O-glucoside)
 
-  Eupalin (Eupalitin 3-0-rhamnoside) 
 
-  Eupatolin (Eupatolitin 3-O-rhamnoside) 
 
-  Jacein (Jaceidin 7-O-glucoside)
 
-  Patulitrin (Patuletin 7-O-glucoside
 
-  Xanthorhamnin (Rhamnetin glycoside)
  
  | 
|---|
 
  | 
|---|
 
  | 
|---|
  |  | Derivative flavonols | Aglycones  | 
-  Noricaritin 
 
-  Dihydronoricaritin
  
  | 
|---|
  |  Glycosides  |  | 
|---|
 
  | 
|---|
  |  | Pyranoflavonols |  | 
|---|
  |  | Furanoflavonols |  | 
|---|
  |  | Semisynthetic |  | 
|---|
 
  |