Tamarixetin
Tamarixetin
 |
| Names |
| IUPAC name
3,5,7-Trihydroxy-2-(3-hydroxy-4-methoxyphenyl)-4H-chromen-4-one |
| Other names
3,3',5,7-Tetrahydroxy-4'-methoxyflavone; 4'-Methylquercetin; 4'-O-Methylquercetin; Quercetin 4'-methyl ether |
| Identifiers |
| |
603-61-2 Y |
| ChEBI |
CHEBI:67492 Y |
| ChemSpider |
4445016 |
| Jmol interactive 3D |
Image |
| PubChem |
5281699 |
| UNII |
73WRA8Z8M8 Y |
InChI=1S/C16H12O7/c1-22-11-3-2-7(4-9(11)18)16-15(21)14(20)13-10(19)5-8(17)6-12(13)23-16/h2-6,17-19,21H,1H3 Key: FPLMIPQZHHQWHN-UHFFFAOYSA-N InChI=1/C16H12O7/c1-22-11-3-2-7(4-9(11)18)16-15(21)14(20)13-10(19)5-8(17)6-12(13)23-16/h2-6,17-19,21H,1H3 Key: FPLMIPQZHHQWHN-UHFFFAOYAK
|
COC1=CC=C(C=C1O)C1=C(O)C(=O)C2=C(O1)C=C(O)C=C2O
|
| Properties |
| |
C16H12O7 |
| Molar mass |
316.27 g·mol−1 |
| Melting point |
307 °C (585 °F; 580 K) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
| Infobox references |
|
|
Tamarixetin is an O-methylated flavonol, a type of chemical compound.
See also
External links
Flavonols and their conjugates |
|---|
| | Backbone | |
|---|
| | Flavonols | Aglycones | |
|---|
| Conjugates | | |
|---|
| |
- Afzelin (Kaempferol 3-rhamnoside)
- Astragalin (kaempferol 3-O-glucoside)
- Kaempferitrin (kaempferol 3,7-dirhamnoside)
- Juglanin (Kaempferol 3-O-arabinoside)
- Kaempferol 3-alpha-L-arabinopyranoside
- Kaempferol 3-alpha-D-arabinopyranoside
- Kaempferol 7-alpha-L-arabinoside
- Kaempferol 7-O-glucoside
- Kaempferol 3-lathyroside
- Kaempferol 4'-rhamnoside
- Kaempferol 5-rhamnoside
- Kaempferol 7-rhamnoside
- Kaempferol 7-O-alpha-L-rhamnofuranoside
- Kaempferol 3-xyloside
- Kaempferol 7-xyloside
- Robinin (kaempferol-3-O-robinoside-7-O-rhamnoside)
- Kaempferol 3-O-rutinoside
- Sophoraflavonoloside (Kaempferol 3-O-sophoroside)
- Trifolin (Kaempferol 3-O-beta-D-galactoside)
|
|---|
| | |
|---|
| | |
|---|
|
|---|
|
|---|
| | O-Methylated flavonols | Aglycones | |
|---|
| Glycosides | of isorhamnetin |
- Narcissin (Isorhamnetin 3-O-rutinoside)
- Isorhamnetin 3-O-glucoside
- Tamarixetin 7-rutinoside
|
|---|
| other |
- Azalein (Azaleatin 3-O-α-L-rhamnoside)
- Centaurein (Centaureidin 7-O-glucoside)
- Eupalin (Eupalitin 3-0-rhamnoside)
- Eupatolin (Eupatolitin 3-O-rhamnoside)
- Jacein (Jaceidin 7-O-glucoside)
- Patulitrin (Patuletin 7-O-glucoside
- Xanthorhamnin (Rhamnetin glycoside)
|
|---|
|
|---|
|
|---|
| | Derivative flavonols | Aglycones |
- Noricaritin
- Dihydronoricaritin
|
|---|
| Glycosides | |
|---|
|
|---|
| | Pyranoflavonols | |
|---|
| | Furanoflavonols | |
|---|
| | Semisynthetic | |
|---|
|